BALQ structure
|
Common Name | BALQ | ||
|---|---|---|---|---|
| CAS Number | 146162-54-1 | Molecular Weight | 512.534 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H25AlN2O3 | Melting Point | 230-232ºC | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | bis[(2-methylquinolin-8-yl)oxy]-(4-phenylphenoxy)alumane |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 230-232ºC |
|---|---|
| Molecular Formula | C32H25AlN2O3 |
| Molecular Weight | 512.534 |
| Exact Mass | 512.168030 |
| PSA | 53.47000 |
| LogP | 7.96930 |
| InChIKey | UFVXQDWNSAGPHN-UHFFFAOYSA-K |
| SMILES | Cc1ccc2cccc(O[Al](Oc3ccc(-c4ccccc4)cc3)Oc3cccc4ccc(C)nc34)c2n1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H361d |
| Precautionary Statements | P261-P281-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Phrases | 63-36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
|
~77%
BALQ CAS#:146162-54-1 |
| Literature: Dai, Lei; Cai, Lifei; Zhao, Hongyu Patent: US2012/130074 A1, 2012 ; Location in patent: Page/Page column 2 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Recent progress of molecular organic electroluminescent materials and devices Hung, L.S.; et al.
Mater. Sci. Eng. R. Rep. 39 , 143 - 222, (2002)
|
| O487 |
| Bis(2-methyl-8-quinolinolato-N1,O8)-(1,1'-Biphenyl-4-olato)aluminum |
| Bis(8-hydroxy-2-methylquinoline)-(4-phenylphenoxy)aluminum |
| 8-Quinolinol, 2-methyl-, compd. with [1,1'-biphenyl]-4-ol, aluminum salt (2:1:1) |
| Aluminium 4-biphenylolate 2-methyl-8-quinolinolate (1:1:2) |
| bis(2-methyl-8-quinolinolato)(4-phenylphenolato)aluminum |
| bis(2-methyl-8-quinolinolato)-4-(phenoxyphenyl) Al |
| aluminum(III)bis(2-methyl-8-quinolinato)(4-phenylphenolate) |
| BAlq |
| ((1,1'-bisphenyl)-4-oleate)bis(2-methyl-quinolinolate)aluminum |
| bis(2-methyl-8-quinolinolato)(4-phenylphenolato)aluminum (III) |
| (1,1'-biphenyl-4-olate)bis(2-methyl-quinoline-8-olate)aluminum |