methyl 15-hydroperoxyoctadeca-9,12,16-trienoate
Modify Date: 2025-11-01 19:18:57
methyl 15-hydroperoxyoctadeca-9,12,16-trienoate structure
|
Common Name | methyl 15-hydroperoxyoctadeca-9,12,16-trienoate | ||
|---|---|---|---|---|
| CAS Number | 14606-85-0 | Molecular Weight | 324.45500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 15-hydroperoxyoctadeca-9,12,16-trienoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H32O4 |
|---|---|
| Molecular Weight | 324.45500 |
| Exact Mass | 324.23000 |
| PSA | 55.76000 |
| LogP | 5.21700 |
| InChIKey | GSDDTQBCPWWRBN-UHFFFAOYSA-N |
| SMILES | CC=CC(CC=CCC=CCCCCCCCC(=O)OC)OO |
|
~%
methyl 15-hydro... CAS#:14606-85-0 |
| Literature: Cobern,D. et al. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 1897 - 1902 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 9,12,16-Octadecatrienoic acid,15-hydroperoxy-,methyl ester |