4,5-dimethyl-3,6-dioctyloxy-1,2-phenylene-bis(mercury trifluoroacetate)
Modify Date: 2025-08-25 21:56:27
4,5-dimethyl-3,6-dioctyloxy-1,2-phenylene-bis(mercury trifluoroacetate) structure
|
Common Name | 4,5-dimethyl-3,6-dioctyloxy-1,2-phenylene-bis(mercury trifluoroacetate) | ||
|---|---|---|---|---|
| CAS Number | 145889-57-2 | Molecular Weight | 987.78400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H40F6Hg2O6 | Melting Point | 177-179ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | [3,4-dimethyl-2,5-dioctoxy-6-[(2,2,2-trifluoroacetyl)oxymercurio]phenyl]-(2,2,2-trifluoroacetyl)oxymercury |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 177-179ºC |
|---|---|
| Molecular Formula | C28H40F6Hg2O6 |
| Molecular Weight | 987.78400 |
| Exact Mass | 990.21400 |
| PSA | 71.06000 |
| LogP | 7.23860 |
| InChIKey | UMYVIFNPTFWRLT-UHFFFAOYSA-L |
| SMILES | CCCCCCCCOc1c(C)c(C)c(OCCCCCCCC)c([Hg]OC(=O)C(F)(F)F)c1[Hg]OC(=O)C(F)(F)F |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H373-H410 |
| Precautionary Statements | P260-P264-P273-P280-P284-P301 + P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Phrases | R33;R26/27/28;R50/53 |
| Safety Phrases | S13-S28-S36-S45-S60-S61 |
| RIDADR | UN 2025 6.1/PG 2 |
| WGK Germany | 3 |
|
Investigation of chloride sensitive ISFETs with different membrane compositions suitable for medical applications. Bratov, Andrey, Natalia Abramova, and Carlos Domi´nguez.
Anal. Chim. Acta 514 , 99-106, (2004)
|
|
|
M. Rothmaier, W. Simon
Anal. Chim. Acta 271 , 135, (1993)
|
| ETH 9009 |
| MFCD00214158 |
| Chloride ionophore II |