4-Chloro-2-Hydroxy-5-Sulfamoylbenzoic Acid structure
|
Common Name | 4-Chloro-2-Hydroxy-5-Sulfamoylbenzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 14556-98-0 | Molecular Weight | 251.64400 | |
| Density | 1.78 g/cm3 | Boiling Point | 528.4ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO5S | Melting Point | 251-256 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 273.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-2-Hydroxy-5-Sulfamoylbenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.78 g/cm3 |
|---|---|
| Boiling Point | 528.4ºC at 760 mmHg |
| Melting Point | 251-256 °C (dec.)(lit.) |
| Molecular Formula | C7H6ClNO5S |
| Molecular Weight | 251.64400 |
| Flash Point | 273.3ºC |
| Exact Mass | 250.96600 |
| PSA | 126.07000 |
| LogP | 2.17230 |
| Vapour Pressure | 5.42E-12mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | FHNZKRYMWHCXME-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(O)cc1Cl |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| MFCD00988990 |
| 4-Chloro-5-sulfamoyl-salicylic Acid |
| EINECS 238-602-2 |
| 4-Chloro-2-hydroxy-5-sulfamoylbenzoic acid |