Sartorypyrone B structure
|
Common Name | Sartorypyrone B | ||
|---|---|---|---|---|
| CAS Number | 1452396-11-0 | Molecular Weight | 514.650 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 582.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H42O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.0±30.2 °C | |
Use of Sartorypyrone BSartorypyrone B is a 2β-acetoxyl analogue of chevalone C. Sartorypyrone B is yielded from the ethyl acetate extract of the culture of the marine sponge-associated fungus Neosartorya tsunodae (KUFC 9213). Sartorypyrone B exhibits strong growth inhibitory activity, having GI50s of 17.8, 20.5, and 25.0 μM, respectively, for MCF-7, NCI-H460, and A375-C5. Sartorypyrone B has the potential for the research of breast adenocarcinoma, non-small cell lung cancer, and melanoma diseases[1]. |
| Name | Sartorypyrone B |
|---|---|
| Synonym | More Synonyms |
| Description | Sartorypyrone B is a 2β-acetoxyl analogue of chevalone C. Sartorypyrone B is yielded from the ethyl acetate extract of the culture of the marine sponge-associated fungus Neosartorya tsunodae (KUFC 9213). Sartorypyrone B exhibits strong growth inhibitory activity, having GI50s of 17.8, 20.5, and 25.0 μM, respectively, for MCF-7, NCI-H460, and A375-C5. Sartorypyrone B has the potential for the research of breast adenocarcinoma, non-small cell lung cancer, and melanoma diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.6±50.0 °C at 760 mmHg |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.650 |
| Flash Point | 244.0±30.2 °C |
| Exact Mass | 514.293030 |
| LogP | 5.84 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | DFAVZYUGRTVMCA-KNUPVKMWSA-N |
| SMILES | CC(=O)OC1CC2(C)C(CCC3(C)C4Cc5c(oc(C)cc5=O)OC4(C)CCC32)C(C)(C)C1OC(C)=O |
| sartorypyrone B |
| 1H,11H-Phenanthro[2,1-b]pyrano[3,2-e]pyran-11-one, 2,3-bis(acetyloxy)-2,3,4,4a,4b,5,6,6a,12,12a,12b,13,14,14a-tetradecahydro-1,1,4a,6a,9,12b-hexamethyl-, (2R,3S,4aR,4bR,6aS,12aS,12bR,14aR)- |
| (2R,3S,4aR,4bR,6aS,12aS,12bR,14aR)-1,1,4a,6a,9,12b-Hexamethyl-11-oxo-2,3,4,4a,4b,5,6,6a,12,12a,12b,13,14,14a-tetradecahydro-1H,11H-naphtho[2,1-f]pyrano[2,3-b]chromene-2,3-diyl diacetate |