1-Ethyl-3-methylimidazolium Methanesulfonate structure
|
Common Name | 1-Ethyl-3-methylimidazolium Methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 145022-45-3 | Molecular Weight | 206.263 | |
| Density | 1.247 | Boiling Point | 363ºC at 760 mmHg | |
| Molecular Formula | C7H14N2O3S | Melting Point | 35ºC | |
| MSDS | Chinese USA | Flash Point | 67ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-Ethyl-3-methylimidazolium Methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247 |
|---|---|
| Boiling Point | 363ºC at 760 mmHg |
| Melting Point | 35ºC |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.263 |
| Flash Point | 67ºC |
| Exact Mass | 206.072510 |
| PSA | 74.39000 |
| LogP | 0.57470 |
| Vapour Pressure | 2.95E-06mmHg at 25°C |
| Index of Refraction | 1.4970 |
| InChIKey | IXLWEDFOKSJYBD-UHFFFAOYSA-M |
| SMILES | CCn1cc[n+](C)c1.CS(=O)(=O)[O-] |
| Water Solubility | Soluble in water. Soluble in acetone, methanol . |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H412 |
| Precautionary Statements | P273-P280 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 2 |
| Packaging Group | III |
| Hazard Class | 8.0 |
| HS Code | 2933290090 |
|
~99%
1-Ethyl-3-methy... CAS#:145022-45-3 |
| Literature: Ignatyev, Nikolai (Mykola); Welz-Biermann, Urs; Kucheryna, Andriy; Willner, Helge Patent: US2008/221334 A1, 2008 ; Location in patent: Page/Page column 9 ; |
|
~95%
1-Ethyl-3-methy... CAS#:145022-45-3 |
| Literature: BASF AKTIENGESELLSCHAFT Patent: WO2005/19183 A1, 2005 ; Location in patent: Page/Page column 22-23 ; |
|
~88%
1-Ethyl-3-methy... CAS#:145022-45-3 |
| Literature: Blesic, Marijana; Swadzba-Kwasny, Malgorzata; Belhocine, Tayeb; Gunaratne, H. Q. Nimal; Lopes, Jose N. Canongia; Gomes, Margarida F. Costa; Padua, Agilio A. H.; Seddon, Kenneth R.; Rebelo, Luis Paulo N. Physical Chemistry Chemical Physics, 2009 , vol. 11, # 39 p. 8939 - 8948 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-ethyl-3-methylimidazol-3-ium,methanesulfonate |
| 1H-Imidazolium, 1-ethyl-3-methyl- methanesulfonate (1:1) |
| 1-Ethyl-3-methylimidazolium methanesulfonate |
| T5K CNJ A2 C1 &&MeSO3- |
| 1-Ethyl-3-methyl-1H-imidazol-3-ium methanesulfonate |
| 1-Ethyl-3-methylimidazolium methylsulfonate |
| MFCD06798171 |