1-(4-morpholin-4-yl-3-nitrophenyl)ethanone
Modify Date: 2025-08-25 17:13:59
1-(4-morpholin-4-yl-3-nitrophenyl)ethanone structure
|
Common Name | 1-(4-morpholin-4-yl-3-nitrophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 144783-46-0 | Molecular Weight | 250.25100 | |
| Density | 1.276g/cm3 | Boiling Point | 412.9ºC at 760mmHg | |
| Molecular Formula | C12H14N2O4 | Melting Point | 79-83ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-morpholin-4-yl-3-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760mmHg |
| Melting Point | 79-83ºC |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25100 |
| Exact Mass | 250.09500 |
| PSA | 75.36000 |
| LogP | 2.22220 |
| Vapour Pressure | 4.99E-07mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | XVHYVLUSJNHBKN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2934999090 |
|
~56%
1-(4-morpholin-... CAS#:144783-46-0 |
| Literature: Varma, Rajendra S; Sarin, Simi; Chatterjee, R K Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1992 , vol. 31, # 10 p. 711 - 713 |
|
~%
1-(4-morpholin-... CAS#:144783-46-0 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 31, # 10 p. 711 - 713 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethanone,1-[4-(4-morpholinyl)-3-nitrophenyl] |
| 1-(4-morpholino-3-nitro-phenyl)-ethanone |
| morpholinonitrophenylethanone |
| 1-(4-Morpholino-3-nitro-phenyl)-aethanon |
| 1-(4-morpholino-3-nitrophenyl)-1-ethanone |