brachynoside heptaacetate
Modify Date: 2025-10-18 12:34:20
brachynoside heptaacetate structure
|
Common Name | brachynoside heptaacetate | ||
|---|---|---|---|---|
| CAS Number | 144765-80-0 | Molecular Weight | 946.897 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 891.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H54O22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.5±34.3 °C | |
| Name | 2-(3,4-Dimethoxyphenyl)ethyl 2,6-di-O-acetyl-4-O-[(2E)-3-(3,4-dia cetoxyphenyl)-2-propenoyl]-3-O-(2,3,4-tri-O-acetyl-6-deoxy-α-L-ma nnopyranosyl)-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 891.1±65.0 °C at 760 mmHg |
| Molecular Formula | C45H54O22 |
| Molecular Weight | 946.897 |
| Flash Point | 344.5±34.3 °C |
| Exact Mass | 946.310669 |
| PSA | 265.78000 |
| LogP | 5.22 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | MSJUZWZZISHWKL-DTQAZKPQSA-N |
| SMILES | COc1ccc(CCOC2OC(COC(C)=O)C(OC(=O)C=Cc3ccc(OC(C)=O)c(OC(C)=O)c3)C(OC3OC(C)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)C2OC(C)=O)cc1OC |
| Hazard Codes | Xi |
|---|
|
~%
brachynoside he... CAS#:144765-80-0 |
| Literature: Lin; Kuo Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 7 p. 1928 - 1929 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| β-D-Glucopyranoside, 2-(3,4-dimethoxyphenyl)ethyl 4-O-[(2E)-3-[3,4-bis(acetyloxy)phenyl]-1-oxo-2-propen-1-yl]-3-O-(2,3,4-tri-O-acetyl-6-deoxy-α-L-mannopyranosyl)-, diacetate |
| 2-(3,4-Dimethoxyphenyl)ethyl 2,6-di-O-acetyl-4-O-[(2E)-3-(3,4-diacetoxyphenyl)-2-propenoyl]-3-O-(2,3,4-tri-O-acetyl-6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |