flupyrsulfuron-methyl-sodium structure
|
Common Name | flupyrsulfuron-methyl-sodium | ||
|---|---|---|---|---|
| CAS Number | 144740-54-5 | Molecular Weight | 487.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13F3N5NaO7S | Melting Point | 172-173° | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS09 |
Signal Word | Warning | |
| Name | flupyrsulfuron-methyl-sodium |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 172-173° |
|---|---|
| Molecular Formula | C15H13F3N5NaO7S |
| Molecular Weight | 487.34300 |
| Exact Mass | 487.03900 |
| PSA | 158.29000 |
| LogP | 2.53510 |
| InChIKey | JKPSVOHVUGMYGH-UHFFFAOYSA-M |
| SMILES | COC(=O)c1ccc(C(F)(F)F)nc1S(=O)(=O)[N-]C(=O)Nc1nc(OC)cc(OC)n1.[Na+] |
| Symbol |
GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H410 |
| Precautionary Statements | P273-P391-P501 |
| Hazard Codes | N: Dangerous for the environment; |
| Risk Phrases | R50/53 |
| Safety Phrases | S60 |
| RIDADR | UN 3077 9 / PGIII |
| flupyrsulfuron-methyl |
| FLUPYRSULFURON-METHYL SODIUM |
| sodium (4,6-dimethoxypyrimidin-2-yl)[({[3-(methoxycarbonyl)-6-(trifluoromethyl)pyridin-2-yl]sulfonyl}amino)carbonyl]azanide |
| sodium (4,6-dimethoxypyrimidin-2-yl){[3-(methoxycarbonyl)-6-(trifluoromethyl)pyridine-2-sulfonyl]carbamoyl}azanide |
| flupyrsulfuron-methyl,sodiumsalt |
| flupysulfuron-methyl |
| sodium salt of methyl 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-6-(trifluoromethyl)-3-pyridinecarboxylate |