Fimaporfin structure
|
Common Name | Fimaporfin | ||
|---|---|---|---|---|
| CAS Number | 1443547-43-0 | Molecular Weight | 776.878 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C44H32N4O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FimaporfinFimaporfin (TPCS2a) is an endosomal/lysosomal-localizing photosensitizer[1]. |
| Name | Fimaporfin B |
|---|---|
| Synonym | More Synonyms |
| Description | Fimaporfin (TPCS2a) is an endosomal/lysosomal-localizing photosensitizer[1]. |
|---|---|
| Related Catalog | |
| In Vitro | The endosomal/lysosomal localizing photosensitizer Fimaporfin (0.35 μg/ml) is used in the drug delivery technology photochemical internalization (PCI) in combination with drugs that usually are trapped in endosomes and/or lysosomes[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C44H32N4O6S2 |
| Molecular Weight | 776.878 |
| Exact Mass | 776.176331 |
| LogP | 8.83 |
| Index of Refraction | 1.690 |
| InChIKey | AINQERPKMNDVQT-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5[nH]c2CC5)C=C4)C=C3)cc1.O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)CC3)cc1.O=S(=O)(O)c1ccc(-c2c3nc(c(-c4ccc(S(=O)(=O)O)cc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)CC4)C=C3)cc1 |
| 4,4'-(15,20-Diphenyl-2,3-dihydroporphyrin-5,10-diyl)dibenzenesulfonic acid |
| Benzenesulfonic acid, 4,4'-(2,3-dihydro-15,20-diphenyl-21H,23H-porphine-5,10-diyl)bis- |
| Fimaporfin B |