5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid
Modify Date: 2025-09-14 13:01:15
5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid structure
|
Common Name | 5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 144252-16-4 | Molecular Weight | 314.33700 | |
| Density | 1.25g/cm3 | Boiling Point | 563.1ºC at 760mmHg | |
| Molecular Formula | C20H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.3ºC | |
| Name | 5-naphthalen-2-yl-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 563.1ºC at 760mmHg |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.33700 |
| Flash Point | 294.3ºC |
| Exact Mass | 314.10600 |
| PSA | 55.12000 |
| LogP | 4.39070 |
| Vapour Pressure | 1.62E-13mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | FPCDSWNFZGRAOI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccc3ccccc3c2)n(-c2ccccc2)n1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Naphth-2-yl-1-phenyl-1H-pyrazole-3-carboxylic acid |