5-[4-(dimethylamino)phenyl]cyclohexane-1,3-dione structure
|
Common Name | 5-[4-(dimethylamino)phenyl]cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 144128-70-1 | Molecular Weight | 231.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO2 | Melting Point | 191-196 ℃(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-[4-(dimethylamino)phenyl]cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 191-196 ℃(lit.) |
|---|---|
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29000 |
| Exact Mass | 231.12600 |
| PSA | 37.38000 |
| LogP | 2.15830 |
| InChIKey | WANNTJAQMZXABU-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C2CC(=O)CC(=O)C2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00174364 |