1-benzylsulfanyl-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol
Modify Date: 2024-09-19 20:43:42
![1-benzylsulfanyl-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol Structure](https://image.chemsrc.com/caspic/096/143759-79-9.png)
1-benzylsulfanyl-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol structure
|
Common Name | 1-benzylsulfanyl-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 143759-79-9 | Molecular Weight | 468.60200 | |
| Density | 1.225g/cm3 | Boiling Point | 595.6ºC at 760 mmHg | |
| Molecular Formula | C27H30F2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314ºC | |
| Name | 1-benzylsulfanyl-3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propan-2-ol |
|---|
| Density | 1.225g/cm3 |
|---|---|
| Boiling Point | 595.6ºC at 760 mmHg |
| Molecular Formula | C27H30F2N2OS |
| Molecular Weight | 468.60200 |
| Flash Point | 314ºC |
| Exact Mass | 468.20500 |
| PSA | 52.01000 |
| LogP | 4.84190 |
| Vapour Pressure | 4.92E-15mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | YALIXOJWFVJMQH-UHFFFAOYSA-N |
| SMILES | OC(CSCc1ccccc1)CN1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
|
~66%
1-benzylsulfany... CAS#:143759-79-9 |
| Literature: Williams, D. Bradley G.; Cullen, Adam Journal of Organic Chemistry, 2009 , vol. 74, # 24 p. 9509 - 9512 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |