1,2,3,4,5,6,7,8-octamethyl-9,10-dihydroanthracene structure
|
Common Name | 1,2,3,4,5,6,7,8-octamethyl-9,10-dihydroanthracene | ||
|---|---|---|---|---|
| CAS Number | 143700-98-5 | Molecular Weight | 292.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5,6,7,8-octamethyl-9,10-dihydroanthracene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H28 |
|---|---|
| Molecular Weight | 292.45800 |
| Exact Mass | 292.21900 |
| LogP | 5.64880 |
| InChIKey | OCQHESDDDWOTRL-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c2c(c1C)Cc1c(C)c(C)c(C)c(C)c1C2 |
|
~%
1,2,3,4,5,6,7,8... CAS#:143700-98-5 |
| Literature: Welch; Smith Journal of the American Chemical Society, 1951 , vol. 73, p. 4391 |
|
~%
1,2,3,4,5,6,7,8... CAS#:143700-98-5 |
| Literature: Welch; Smith Journal of the American Chemical Society, 1951 , vol. 73, p. 4391 |
|
~%
1,2,3,4,5,6,7,8... CAS#:143700-98-5 |
| Literature: Backer; Strating; Huisman Recueil des Travaux Chimiques des Pays-Bas, 1939 , vol. 58, p. 761,770 |
| Anthracene,9,10-dihydro-1,2,3,4,5,6,7,8-octamethyl |
| 9,10-Dihydro-1,2,3,4,5,6,7,8-octamethylanthracen |
| 1,2,3,4,5,6,7,8-octamethyl-9,10-dihydro-anthracene |
| 1,2,3,4,5,6,7,8-Octamethyl-9,10-dihydro-anthracen |