2,7-dibromo-9-fluorenone structure
|
Common Name | 2,7-dibromo-9-fluorenone | ||
|---|---|---|---|---|
| CAS Number | 14348-75-5 | Molecular Weight | 337.994 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 451.4±38.0 °C at 760 mmHg | |
| Molecular Formula | C13H6Br2O | Melting Point | 203-205 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 163.1±13.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,7-Dibromo-9-fluorenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.4±38.0 °C at 760 mmHg |
| Melting Point | 203-205 °C(lit.) |
| Molecular Formula | C13H6Br2O |
| Molecular Weight | 337.994 |
| Flash Point | 163.1±13.3 °C |
| Exact Mass | 335.878540 |
| PSA | 17.07000 |
| LogP | 5.12 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | CWGRCRZFJOXQFV-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(Br)ccc2-c2ccc(Br)cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
|
Supramolecular luminescence from oligofluorenol-based supramolecular polymer semiconductors.
Int. J. Mol. Sci. 14 , 22368-79, (2013) Supramolecular luminescence stems from non-covalent exciton behaviors of active π-segments in supramolecular entities or aggregates via intermolecular forces. Herein, a π-conjugated oligofluorenol, co... |
|
|
A precursor route to 2, 7-poly (9-fluorenone). Uckert F, et al.
Macromolecules 32(14) , 4519-24, (1999)
|
|
|
Efficient White-Electrophosphorescent Devices Based on a Single Polyfluorene Copolymer. Wu F-I, et al.
Adv. Funct. Mater. 17(7) , 1085-92, (2007)
|
| 2,7-Dibromo-9H-fluoren-9-one |
| MFCD00010790 |
| 9H-Fluoren-9-one, 2,7-dibromo- |
| 2,7-Dibromofluorenone |