BOC-L-4-tBu-phe structure
|
Common Name | BOC-L-4-tBu-phe | ||
|---|---|---|---|---|
| CAS Number | 143415-62-7 | Molecular Weight | 321.411 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 461.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C18H27NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 232.9±27.3 °C | |
| Name | (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-(tert-butyl)phenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 461.4±40.0 °C at 760 mmHg |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.411 |
| Flash Point | 232.9±27.3 °C |
| Exact Mass | 321.194000 |
| PSA | 75.63000 |
| LogP | 4.65 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | NGWQIBYYDHXJJR-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(C(C)(C)C)cc1)C(=O)O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-(1,1-dimethylethyl)- |
| MFCD02094432 |
| Boc-4-tert-butyl-L-phenylalanine |
| 4-(2-Methyl-2-propanyl)-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| (2S)-3-(4-tert-butylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |