Bicyclo[2.2.1]hept-5-en-2-yl(trichloro)silane structure
|
Common Name | Bicyclo[2.2.1]hept-5-en-2-yl(trichloro)silane | ||
|---|---|---|---|---|
| CAS Number | 14319-64-3 | Molecular Weight | 227.591 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 220.8±29.0 °C at 760 mmHg | |
| Molecular Formula | C7H9Cl3Si | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 100.0±19.0 °C | |
| Name | 5-bicyclo[2.2.1]hept-2-enyl(trichloro)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 220.8±29.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C7H9Cl3Si |
| Molecular Weight | 227.591 |
| Flash Point | 100.0±19.0 °C |
| Exact Mass | 225.953903 |
| LogP | 5.79 |
| Vapour Pressure | 0.2±0.4 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | RDAOXVBXDCANBV-UHFFFAOYSA-N |
| SMILES | Cl[Si](Cl)(Cl)C1CC2C=CC1C2 |
| Risk Phrases | 34-36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 2987 |
| HS Code | 2931900090 |
|
~%
Bicyclo[2.2.1]h... CAS#:14319-64-3 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 31, # 4 p. 1199 - 1208,1109 - 1117 |
|
~89%
Bicyclo[2.2.1]h... CAS#:14319-64-3 |
| Literature: Tacke, Reinhold; Pikies, Jerzy; Wiesenberger, Frank; Ernst, Ludger; Schomburg, Dietmar; et al. Journal of Organometallic Chemistry, 1994 , vol. 466, # 1-2 p. 15 - 28 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bicyclo[2.2.1]hept-2-ene, 5-(trichlorosilyl)- |
| norborn-5-en-2-yltrichlorosilane |
| 5-trichlorosilanyl-2-norbornene |
| BICYCLOHEPTENYL-2-TRICHLOROSILANE |
| Silane, bicyclo[2.2.1]hept-5-en-2-yltrichloro- |
| (bicyclo[2.2.1]hept-5-en-2-yl)trichlorosilane |
| (Bicyclo<2.2.1>hept-5-en-2-yl)trichlorsilan |
| 5-(trichlorosilyl)norbornene-2 |
| Bicyclo[2.2.1]hept-5-en-2-yl(trichloro)silane |
| 5-trichlorosilane-2-norbornene |
| 5-trichlorsilylbicyclo<2.2.1>hept-2-en |
| Silane,bicyclo[2.2.1]hept-5-en-2-yltrichloro |