3-methyl-N-(4-phenylbutan-2-yl)butanamide structure
|
Common Name | 3-methyl-N-(4-phenylbutan-2-yl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 143085-87-4 | Molecular Weight | 233.34900 | |
| Density | 0.954g/cm3 | Boiling Point | 392.7ºC at 760 mmHg | |
| Molecular Formula | C15H23NO | Melting Point | 52ºC | |
| MSDS | N/A | Flash Point | 239.1ºC | |
| Name | 3-methyl-N-(4-phenylbutan-2-yl)butanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.954g/cm3 |
|---|---|
| Boiling Point | 392.7ºC at 760 mmHg |
| Melting Point | 52ºC |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.34900 |
| Flash Point | 239.1ºC |
| Exact Mass | 233.17800 |
| PSA | 29.10000 |
| LogP | 3.56090 |
| Vapour Pressure | 2.25E-06mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | KIJQPTRIOXCOEG-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)NC(C)CCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(1-Methyl-3-phenylpropyl)isovaleramide |
| 3-Isovaleramido-1-phenylbutane |