1,3-Dioctanoyl Glycerol
Modify Date: 2025-08-25 15:17:30
1,3-Dioctanoyl Glycerol structure
|
Common Name | 1,3-Dioctanoyl Glycerol | ||
|---|---|---|---|---|
| CAS Number | 1429-66-9 | Molecular Weight | 344.48600 | |
| Density | 0.992±0.06 g/cm3 | Boiling Point | 439.9±12.0 °C at 760 mmHg | |
| Molecular Formula | C19H36O5 | Melting Point | <4 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-Dcg |
|---|---|
| Synonym | More Synonyms |
| Density | 0.992±0.06 g/cm3 |
|---|---|
| Boiling Point | 439.9±12.0 °C at 760 mmHg |
| Melting Point | <4 °C |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.48600 |
| Exact Mass | 344.25600 |
| PSA | 72.83000 |
| LogP | 4.15470 |
| InChIKey | DMBAVJVECSKEPF-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| MFCD00056316 |