dibromoTPD (heptyl) structure
|
Common Name | dibromoTPD (heptyl) | ||
|---|---|---|---|---|
| CAS Number | 1427705-63-2 | Molecular Weight | 409.13700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15Br2NO2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 1,3-dibromo-5-(n-heptyl)-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione |
|---|
| Molecular Formula | C13H15Br2NO2S |
|---|---|
| Molecular Weight | 409.13700 |
| Exact Mass | 406.91900 |
| PSA | 65.62000 |
| LogP | 4.77740 |
| InChIKey | MUFYLDXTAFDZRE-UHFFFAOYSA-N |
| SMILES | CCCCCCCN1C(=O)c2c(Br)sc(Br)c2C1=O |
|
Linear side chains in benzo[1,2-b:4,5-b']dithiophene-thieno[3,4-c]pyrrole-4,6-dione polymers direct self-assembly and solar cell performance.
J. Am. Chem. Soc. 135 , 4656-4659, (2013) While varying the size and branching of solubilizing side chains in π-conjugated polymers impacts their self-assembling properties in thin-film devices, these structural changes remain difficult to an... |