FR 139317
Modify Date: 2025-08-21 19:45:45
FR 139317 structure
|
Common Name | FR 139317 | ||
|---|---|---|---|---|
| CAS Number | 142375-60-8 | Molecular Weight | 604.74000 | |
| Density | 1.27 g/cm3 | Boiling Point | 943.9ºC at 760 mmHg | |
| Molecular Formula | C33H44N6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 524.6ºC | |
Use of FR 139317FR 139317 is a highly potent and selective antagonist of ETA endothelin receptor, with Ki values of 1 nM and 7.3 μM for ETA and ETB subtypes, respectively. |
| Name | (R)2-[(R)-2[(S)-2[[1-(hexahydro-1H-azepinyl)] carbonyl] amino-4-methylpentanoyl] amino-3-[3-(1-methyl-1H-indolyl)] propionyl] amino-3-(2-pyridyl) propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27 g/cm3 |
|---|---|
| Boiling Point | 943.9ºC at 760 mmHg |
| Molecular Formula | C33H44N6O5 |
| Molecular Weight | 604.74000 |
| Flash Point | 524.6ºC |
| Exact Mass | 604.33700 |
| PSA | 145.66000 |
| LogP | 4.52360 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | LIOKMIQQPDDTNO-UPRLRBBYSA-N |
| SMILES | CC(C)CC(NC(=O)N1CCCCCC1)C(=O)NC(Cc1cn(C)c2ccccc12)C(=O)NC(Cc1ccccn1)C(=O)O |
| 4-BMA |
| 1-Bma Or 4-Bma |
| Side chain for iMipe |
| 1-BMA |
| B-METHYLAZETIDIN-2-ONE |
| SS-METHYLAZETIDIN-2-ONE |