(-)-Ketoconazole
Modify Date: 2025-09-20 23:59:07
(-)-Ketoconazole structure
|
Common Name | (-)-Ketoconazole | ||
|---|---|---|---|---|
| CAS Number | 142128-57-2 | Molecular Weight | 531.431 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 753.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H28Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 409.4±32.9 °C | |
Use of (-)-Ketoconazole(-)-Ketoconazole is one of the enantiomer of Ketoconazole. Ketoconazole is a racemic mixture of two enantiomers, levoketoconazole ((2S,4R)-(−)-ketoconazole) and dextroketoconazole ((2R,4S)-(+)-ketoconazole). |
| Name | Levoketoconazole |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Ketoconazole is one of the enantiomer of Ketoconazole. Ketoconazole is a racemic mixture of two enantiomers, levoketoconazole ((2S,4R)-(−)-ketoconazole) and dextroketoconazole ((2R,4S)-(+)-ketoconazole). |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 753.4±60.0 °C at 760 mmHg |
| Molecular Formula | C26H28Cl2N4O4 |
| Molecular Weight | 531.431 |
| Flash Point | 409.4±32.9 °C |
| Exact Mass | 530.148743 |
| LogP | 3.55 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | XMAYWYJOQHXEEK-ZEQKJWHPSA-N |
| SMILES | CC(=O)N1CCN(c2ccc(OCC3COC(Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| KETOCONAZOLE, (2S,4R)- |
| MFCD25509433 |
| 4594 |
| COR-003 |
| (2S,4R)-ketoconazole |
| 1-[4-(4-{[(2S,4R)-2-(2,4-Dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy}phenyl)-1-piperazinyl]ethanone |
| 2DJ8R0NT7K |
| Ethanone, 1-[4-[4-[[(2S,4R)-2-(2,4-dichlorophenyl)-2-(1H-imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]-1-piperazinyl]- |
| R9400W927I |
| UNII:R9400W927I |
| 10206 |
| Levoketoconazole |
| MFCD00058579 |
| EINECS 265-667-4 |
| UNII-2DJ8R0NT7K |
| (-)-Ketoconazole |