Cilofexor
Modify Date: 2025-08-20 19:34:22
Cilofexor structure
|
Common Name | Cilofexor | ||
|---|---|---|---|---|
| CAS Number | 1418274-28-8 | Molecular Weight | 586.850 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 855.5±65.0 °C at 760 mmHg | |
| Molecular Formula | C28H22Cl3N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 471.2±34.3 °C | |
Use of CilofexorCilofexor is a farnesoid X receptor (FXR) agonist. |
| Name | Cilofexor |
|---|---|
| Synonym | More Synonyms |
| Description | Cilofexor is a farnesoid X receptor (FXR) agonist. |
|---|---|
| Related Catalog | |
| Target |
FXR[1]. |
| References |
[1]. US9820979B2. |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 855.5±65.0 °C at 760 mmHg |
| Molecular Formula | C28H22Cl3N3O5 |
| Molecular Weight | 586.850 |
| Flash Point | 471.2±34.3 °C |
| Exact Mass | 585.062500 |
| LogP | 4.98 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | KZSKGLFYQAYZCO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccnc(N2CC(O)(c3ccc(OCc4c(-c5c(Cl)cccc5Cl)noc4C4CC4)cc3Cl)C2)c1 |
| Storage condition | 2-8℃ |
| 2-[3-(2-Chloro-4-{[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy}phenyl)-3-hydroxy-1-azetidinyl]isonicotinic acid |
| 4-Pyridinecarboxylic acid, 2-[3-[2-chloro-4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4-isoxazolyl]methoxy]phenyl]-3-hydroxy-1-azetidinyl]- |
| Cilofexor |