trichodecenin I
Modify Date: 2025-09-21 21:10:51
trichodecenin I structure
|
Common Name | trichodecenin I | ||
|---|---|---|---|---|
| CAS Number | 141024-74-0 | Molecular Weight | 751.99700 | |
| Density | 1.088g/cm3 | Boiling Point | 1072ºC at 760mmHg | |
| Molecular Formula | C38H69N7O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 602.1ºC | |
Use of trichodecenin ITrichodecenin I, a fungal metabolite, is a peptaibol composed of 7 amino acid residues[1]. |
| Name | (E)-N-[2-[[2-[[1-[[1-[[2-[[1-[(1-hydroxy-4-methylpentan-2-yl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-methyl-1-oxopropan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]dec-4-enamide |
|---|
| Description | Trichodecenin I, a fungal metabolite, is a peptaibol composed of 7 amino acid residues[1]. |
|---|---|
| Related Catalog | |
| Target |
Microbial Metabolite |
| References |
| Density | 1.088g/cm3 |
|---|---|
| Boiling Point | 1072ºC at 760mmHg |
| Molecular Formula | C38H69N7O8 |
| Molecular Weight | 751.99700 |
| Flash Point | 602.1ºC |
| Exact Mass | 751.52100 |
| PSA | 248.36000 |
| LogP | 7.61360 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | BJULECFFERYMOK-FOCLMDBBSA-N |
| SMILES | CCCCCC=CCCC(=O)NCC(=O)NCC(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)NC(C(=O)NC(CO)CC(C)C)C(C)CC |