Butanal, 2-ethyl-,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Butanal, 2-ethyl-,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 14086-21-6 | Molecular Weight | 280.28000 | |
| Density | 1.29g/cm3 | Boiling Point | 417.5ºC at 760mmHg | |
| Molecular Formula | C12H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.3ºC | |
| Name | N-(2-ethylbutylideneamino)-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 417.5ºC at 760mmHg |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28000 |
| Flash Point | 206.3ºC |
| Exact Mass | 280.11700 |
| PSA | 116.03000 |
| LogP | 4.45630 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | PJQWUVGTXBCLCM-MDWZMJQESA-N |
| SMILES | CCC(C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CC |
| HS Code | 2928000090 |
|---|
|
~%
Butanal, 2-ethy... CAS#:14086-21-6 |
| Literature: Drake; Marvel Journal of Organic Chemistry, 1937 , vol. 2, p. 396 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-ethyl-butyraldehyde-(2,4-dinitro-phenylhydrazone) |
| 2-Aethyl-butyraldehyd-(2,4-dinitro-phenylhydrazon) |
| N-(2-ETHYLBUTYLIDENEAMINO)-2,4-DINITRO-ANILINE |
| Butanal,2-ethyl-,2-(2,4-dinitrophenyl)hydrazone |
| Butanal,2-ethyl-,(2,4-dinitrophenyl)hydrazone (9CI) |
| Butyraldehyde,2-ethyl-,(2,4-dinitrophenyl)hydrazone (6CI,8CI) |
| 2.4-Dinitro-phenylhydrazon des Diaethylacetaldehyds |
| 2-Ethyl-butanal-(1)-2,4-dinitro-phenylhydrazon |
| 2-Ethyl-3-butenal(2,4-dinitrophenyl)hydrazone |