Propanal, 2,2-dimethyl-, (2,4-dinitrophenyl)hydrazone structure
|
Common Name | Propanal, 2,2-dimethyl-, (2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 13608-36-1 | Molecular Weight | 266.25300 | |
| Density | 1.3g/cm3 | Boiling Point | 399.4ºC at 760 mmHg | |
| Molecular Formula | C11H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.3ºC | |
| Name | N-[(E)-2,2-dimethylpropylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 399.4ºC at 760 mmHg |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.25300 |
| Flash Point | 195.3ºC |
| Exact Mass | 266.10200 |
| PSA | 116.03000 |
| LogP | 4.06620 |
| Vapour Pressure | 1.37E-06mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | ORILNCDDCQWASM-GHXNOFRVSA-N |
| SMILES | CC(C)(C)C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| 2,4-dinitrophenylhydrazone of 2,2-dimethylpropionaldehyde |
| 2,4-dinitrophenylhydrazone |