4,4'-(Propane-1,3-diylbis(oxy))bis(5-methoxy-2-nitrobenzoic acid) structure
|
Common Name | 4,4'-(Propane-1,3-diylbis(oxy))bis(5-methoxy-2-nitrobenzoic acid) | ||
|---|---|---|---|---|
| CAS Number | 140658-45-3 | Molecular Weight | 466.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18N2O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-(4-carboxy-2-methoxy-5-nitrophenoxy)propoxy]-5-methoxy-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H18N2O12 |
|---|---|
| Molecular Weight | 466.35200 |
| Exact Mass | 466.08600 |
| PSA | 203.16000 |
| LogP | 3.81090 |
| InChIKey | HZOJLJBJSQWDQU-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)c([N+](=O)[O-])cc1OCCCOc1cc([N+](=O)[O-])c(C(=O)O)cc1OC |
|
~%
4,4'-(Propane-1... CAS#:140658-45-3 |
| Literature: Bose; Thompson; Smellie; Berardini; Hartley; Jenkins; Neidle; Thurston Journal of the Chemical Society - Series Chemical Communications, 1992 , # 20 p. 1518 - 1520 |
|
~%
4,4'-(Propane-1... CAS#:140658-45-3 |
| Literature: SPIROGEN SÀRL; HOWARD, Philip Wilson Patent: WO2014/57073 A1, 2014 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzoic acid,4,4'-[1,3-propanediylbis(oxy)]bis[5-methoxy-2-nitro |
| 1',3'-bis(4-carboxy-2-methoxy-5-nitrophenoxy)propane |