3-BENZYL-7-ETHYL-3,7-DIHYDRO-PURINE-2,6-DIONE structure
|
Common Name | 3-BENZYL-7-ETHYL-3,7-DIHYDRO-PURINE-2,6-DIONE | ||
|---|---|---|---|---|
| CAS Number | 139927-85-8 | Molecular Weight | 270.28700 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-benzyl-7-ethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.28700 |
| Exact Mass | 270.11200 |
| PSA | 72.68000 |
| LogP | 0.95450 |
| Index of Refraction | 1.685 |
| InChIKey | XEPOHOPPWDSWQR-UHFFFAOYSA-N |
| SMILES | CCn1cnc2c1c(=O)[nH]c(=O)n2Cc1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~%
3-BENZYL-7-ETHY... CAS#:139927-85-8 |
| Literature: Fujii; Saito; Tamura Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 11 p. 2855 - 2862 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-benzyl-7-ethylxanthine |
| 1H-Purine-2,6-dione,7-ethyl-3,7-dihydro-3-(phenylmethyl) |
| 3-Benzyl-7-ethyl-3,7-dihydro-purine-2,6-dione |