3,7-DIBENZYL-3,7-DIHYDRO-PURINE-2,6-DIONE
Modify Date: 2025-08-25 14:50:38
3,7-DIBENZYL-3,7-DIHYDRO-PURINE-2,6-DIONE structure
|
Common Name | 3,7-DIBENZYL-3,7-DIHYDRO-PURINE-2,6-DIONE | ||
|---|---|---|---|---|
| CAS Number | 139927-86-9 | Molecular Weight | 332.35600 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,7-dibenzylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.35600 |
| Exact Mass | 332.12700 |
| PSA | 72.94000 |
| LogP | 2.39520 |
| Index of Refraction | 1.691 |
| InChIKey | GMANCBOGUXSDSL-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(Cc2ccccc2)c2ncn(Cc3ccccc3)c12 |
| HS Code | 2933990090 |
|---|
|
~%
3,7-DIBENZYL-3,... CAS#:139927-86-9 |
| Literature: Fujii; Saito; Tamura Chemical and Pharmaceutical Bulletin, 1991 , vol. 39, # 11 p. 2855 - 2862 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,7-Dibenzyl-3,7-dihydro-purine-2,6-dione |
| 3,7-dibenzyl-xanthine |