(r)-6-methoxy-2,5,7,8-tetramethylchromane-2-carboxylic acid structure
|
Common Name | (r)-6-methoxy-2,5,7,8-tetramethylchromane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 139658-04-1 | Molecular Weight | 264.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O4 | Melting Point | 149-155ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | (2R)-6-methoxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 149-155ºC |
|---|---|
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Exact Mass | 264.13600 |
| PSA | 55.76000 |
| LogP | 2.78870 |
| InChIKey | MNBMVDGIDVXTOF-OAHLLOKOSA-N |
| SMILES | COc1c(C)c(C)c2c(c1C)CCC(C)(C(=O)O)O2 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Spontaneous intersubunit rotation in single ribosomes.
Mol. Cell. 30 , 578-88, (2008) During the elongation cycle, tRNA and mRNA undergo coupled translocation through the ribosome catalyzed by elongation factor G (EF-G). Cryo-EM reconstructions of certain EF-G-containing complexes led ... |
| i04-1515 |