JNJ-40355003
Modify Date: 2025-08-25 17:04:39
JNJ-40355003 structure
|
Common Name | JNJ-40355003 | ||
|---|---|---|---|---|
| CAS Number | 1394894-41-7 | Molecular Weight | 422.90700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of JNJ-40355003JNJ-40355003 is a potent and selective atty acid amide hydrolase (FAAH) inhibitor[1]. |
| Name | 4-[[3-(4-chlorophenoxy)phenyl]methyl]-N-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | JNJ-40355003 is a potent and selective atty acid amide hydrolase (FAAH) inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H23ClN4O2 |
|---|---|
| Molecular Weight | 422.90700 |
| Exact Mass | 422.15100 |
| PSA | 61.19000 |
| LogP | 4.76640 |
| InChIKey | CTYVKSQPMCSUOR-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccnc1)N1CCN(Cc2cccc(Oc3ccc(Cl)cc3)c2)CC1 |
| 1-Piperazinecarboxamide,4-((3-(4-chlorophenoxy)phenyl)methyl)-N-3-pyridinyl |
| UNII-Z0O8PGE4TB |