Fmoc-Val-Ala-PAB-OH
Modify Date: 2025-09-16 22:19:40
Fmoc-Val-Ala-PAB-OH structure
|
Common Name | Fmoc-Val-Ala-PAB-OH | ||
|---|---|---|---|---|
| CAS Number | 1394238-91-5 | Molecular Weight | 515.600 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 811.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C30H33N3O5 | Melting Point | 218 °C(dec.) | |
| MSDS | N/A | Flash Point | 444.4±34.3 °C | |
Use of Fmoc-Val-Ala-PAB-OHFmoc-Val-Ala-PAB-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Val-Ala-PAB-OH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 811.1±65.0 °C at 760 mmHg |
| Melting Point | 218 °C(dec.) |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.600 |
| Flash Point | 444.4±34.3 °C |
| Exact Mass | 515.242004 |
| LogP | 4.13 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | PIEQFKSWCKVBTP-PPHZAIPVSA-N |
| SMILES | CC(NC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C)C(=O)Nc1ccc(CO)cc1 |
| Hazard Codes | Xi |
|---|
| MFCD29078523 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide |
| L-Alaninamide, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-valyl-N-[4-(hydroxymethyl)phenyl]- |