3,4-Bis(cyclopropylmethoxy)-N-(3,5-dichloropyridin-4-yl)benzamide structure
|
Common Name | 3,4-Bis(cyclopropylmethoxy)-N-(3,5-dichloropyridin-4-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 1391052-24-6 | Molecular Weight | 407.290 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 479.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H20Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.9±28.7 °C | |
| Name | 3,4-Di(cyclopropylmethoxy) Roflumilast |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.7±45.0 °C at 760 mmHg |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.290 |
| Flash Point | 243.9±28.7 °C |
| Exact Mass | 406.085083 |
| PSA | 63.68000 |
| LogP | 5.55 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | YQDXYEVCMGROIA-UHFFFAOYSA-N |
| SMILES | O=C(Nc1c(Cl)cncc1Cl)c1ccc(OCC2CC2)c(OCC2CC2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzamide, 3,4-bis(cyclopropylmethoxy)-N-(3,5-dichloro-4-pyridinyl)- |
| 3,4-Bis(cyclopropylmethoxy)-N-(3,5-dichloro-4-pyridinyl)benzamide |
| 3,4-bis(cyclopropylmethoxy)-N-(3,5-dichloropyridin-4-yl)benzamide |