Aldose reductase-IN-3
Modify Date: 2025-08-26 22:42:09
Aldose reductase-IN-3 structure
|
Common Name | Aldose reductase-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 1390616-76-8 | Molecular Weight | 401.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12ClN3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Aldose reductase-IN-3Aldose reductase-IN-3 (Compound 5) is a potent and moderately selective inhibitor of aldose reductase (AR) with an IC50 of 3.99 μM. Aldose reductase has recently emerged as a molecular target that is involved in various inflammatory diseases, including sepsis. Aldose reductase-IN-3 has the potential for the research of sepsis[1]. |
| Name | Aldose reductase-IN-3 |
|---|
| Description | Aldose reductase-IN-3 (Compound 5) is a potent and moderately selective inhibitor of aldose reductase (AR) with an IC50 of 3.99 μM. Aldose reductase has recently emerged as a molecular target that is involved in various inflammatory diseases, including sepsis. Aldose reductase-IN-3 has the potential for the research of sepsis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H12ClN3O2S2 |
|---|---|
| Molecular Weight | 401.89 |
| InChIKey | VXOAIZOEANHDCR-NVNXTCNLSA-N |
| SMILES | COc1ccc2nc(N=C3NC(=O)C(=Cc4ccc(Cl)cc4)S3)sc2c1 |