Amino-PEG12-Boc
Modify Date: 2025-08-27 23:38:34
Amino-PEG12-Boc structure
|
Common Name | Amino-PEG12-Boc | ||
|---|---|---|---|---|
| CAS Number | 1383814-00-3 | Molecular Weight | 673.830 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 665.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C31H63NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 59.5±26.4 °C | |
Use of Amino-PEG12-BocAmino-PEG12-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | H2N-PEG12-tBu |
|---|---|
| Synonym | More Synonyms |
| Description | Amino-PEG12-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 665.0±50.0 °C at 760 mmHg |
| Molecular Formula | C31H63NO14 |
| Molecular Weight | 673.830 |
| Flash Point | 59.5±26.4 °C |
| Exact Mass | 673.424866 |
| LogP | -3.10 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | XRYCYKGEIYZQGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
| MFCD11041147 |
| 3,6,9,12,15,18,21,24,27,30,33,36-Dodecaoxanonatriacontan-39-oic acid, 1-amino-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 1-amino-3,6,9,12,15,18,21,24,27,30,33,36-dodecaoxanonatriacontan-39-oate |