s-[n-(3-phenylpropyl)(thiocarbamoyl)]-l-cysteine
Modify Date: 2025-08-25 11:38:14
![s-[n-(3-phenylpropyl)(thiocarbamoyl)]-l-cysteine Structure](https://image.chemsrc.com/caspic/366/137915-13-0.png)
s-[n-(3-phenylpropyl)(thiocarbamoyl)]-l-cysteine structure
|
Common Name | s-[n-(3-phenylpropyl)(thiocarbamoyl)]-l-cysteine | ||
|---|---|---|---|---|
| CAS Number | 137915-13-0 | Molecular Weight | 298.42400 | |
| Density | 1.29 g/cm3 | Boiling Point | 479.1ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O2S2 | Melting Point | 224ºC-225ºC (dec.; lit.) | |
| MSDS | N/A | Flash Point | 243.5ºC | |
| Name | (2R)-2-amino-3-(3-phenylpropylcarbamothioylsulfanyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29 g/cm3 |
|---|---|
| Boiling Point | 479.1ºC at 760 mmHg |
| Melting Point | 224ºC-225ºC (dec.; lit.) |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.42400 |
| Flash Point | 243.5ºC |
| Exact Mass | 298.08100 |
| PSA | 132.74000 |
| LogP | 2.73000 |
| Vapour Pressure | 5.49E-10mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | XMEUXBMTQJJHED-NSHDSACASA-N |
| SMILES | NC(CSC(=S)NCCCc1ccccc1)C(=O)O |
|
~94%
s-[n-(3-phenylp... CAS#:137915-13-0 |
| Literature: Zheng, Guo-qiang; Kenney, Patrick M.; Lam, Luke K. T. Journal of Medicinal Chemistry, 1992 , vol. 35, # 1 p. 185 - 188 |
|
~%
s-[n-(3-phenylp... CAS#:137915-13-0 |
| Literature: Food and Chemical Toxicology, , vol. 34, # 4 p. 385 - 392 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| L-Cysteine,(3-phenylpropyl)carbamodithioate (ester) (9CI) |
| S-(N-Phenylpropylthiocarbamoyl)cysteine |
| 2-AZIDO-1,3-DI-O-PIVALOYL-D-ERYTHRO-SPHINGOSINE |
| S-(N-(3-Phenylpropyl)(thiocarbamoyl))-cysteine |
| L-Cysteine,(3-phenylpropyl)carbamodithioate (ester) |
| Pptc-cysteine |
| S-<N-(3-phenylpropyl)(thiocarbamoyl)>-L-cysteine |