Histone H3 (1-25), amide
Modify Date: 2025-08-25 20:01:45
Histone H3 (1-25), amide structure
|
Common Name | Histone H3 (1-25), amide | ||
|---|---|---|---|---|
| CAS Number | 1373320-65-0 | Molecular Weight | 2625.10 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C110H202N42O32 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Histone H3 (1-25), amideHistone H3 (1-25), amide is an N-terminal peptide fragment of histone H3. Histone H3 (1-25), amide can be used to identify the substrate for histone methyltransferases (HMTs). Histone H3 (1-25), amide, as a substrate for HMT G9a, shows more efficient than histone H3 (15-39) and full-length histone H3[1]. |
| Name | Histone H3 (1-25), amide |
|---|
| Description | Histone H3 (1-25), amide is an N-terminal peptide fragment of histone H3. Histone H3 (1-25), amide can be used to identify the substrate for histone methyltransferases (HMTs). Histone H3 (1-25), amide, as a substrate for HMT G9a, shows more efficient than histone H3 (15-39) and full-length histone H3[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C110H202N42O32 |
|---|---|
| Molecular Weight | 2625.10 |
| InChIKey | YNLQDZAEUXMPIO-FZRLICTESA-N |
| SMILES | CC(C)CC(NC(=O)C(CCC(N)=O)NC(=O)C(CCCCN)NC(=O)C(CCCNC(=N)N)NC(=O)C1CCCN1C(=O)C(C)NC(=O)C(CCCCN)NC(=O)CNC(=O)CNC(=O)C(NC(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(CCCNC(=N)N)NC(=O)C(C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCCCN)NC(=O)C(NC(=O)C(CCCNC(=N)N)NC(=O)C(C)N)C(C)O)C(C)O)C(C)O)C(=O)NC(C)C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(C)C(=O)NC(C)C(N)=O)C(C)O |