2,6-bis(benzylideneamino)-1H-pyrimidin-4-one structure
|
Common Name | 2,6-bis(benzylideneamino)-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 137205-94-8 | Molecular Weight | 302.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-bis(benzylideneamino)-1H-pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14N4O |
|---|---|
| Molecular Weight | 302.33000 |
| Exact Mass | 302.11700 |
| PSA | 70.73000 |
| LogP | 3.68340 |
| InChIKey | HWQCRYLPLXEDLY-KVOOEGMKSA-N |
| SMILES | O=c1cc(N=Cc2ccccc2)nc(N=Cc2ccccc2)[nH]1 |
|
~60%
2,6-bis(benzyli... CAS#:137205-94-8 |
| Literature: Ladva; Dave; Parekh Journal of the Indian Chemical Society, 1991 , vol. 68, # 6 p. 370 - 371 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Bis-benzalamino-6-hydroxypyrimidine |
| 4(1H)-Pyrimidinone,2,6-bis[(phenylmethylene)amino] |