p-chloromethylphenyltrichlorosilane
Modify Date: 2025-08-25 16:30:10
p-chloromethylphenyltrichlorosilane structure
|
Common Name | p-chloromethylphenyltrichlorosilane | ||
|---|---|---|---|---|
| CAS Number | 13688-90-9 | Molecular Weight | 260.020 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 270.4±15.0 °C at 760 mmHg | |
| Molecular Formula | C7H6Cl4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8±15.2 °C | |
| Name | trichloro-[4-(chloromethyl)phenyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.4±15.0 °C at 760 mmHg |
| Molecular Formula | C7H6Cl4Si |
| Molecular Weight | 260.020 |
| Flash Point | 130.8±15.2 °C |
| Exact Mass | 257.899292 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | YBYBQFPZMKPGPJ-UHFFFAOYSA-N |
| SMILES | ClCc1ccc([Si](Cl)(Cl)Cl)cc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R14;R34 |
| Safety Phrases | S26-S27-S36/37/39-S45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2931900090 |
|
~%
p-chloromethylp... CAS#:13688-90-9 |
| Literature: Zhurnal Obshchei Khimii, , vol. 27, p. 2786,2789; engl. Ausg. S. 2822, 2824 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzene, 1-(chloromethyl)-4-(trichlorosilyl)- |
| MFCD00045268 |
| Trichloro(4-(chloromethyl)phenyl)silane |
| EINECS 237-203-0 |
| p-Trichlorsilyl-benzylchlorid |
| p-chloromethylphenyltrichlorosilane |
| 4-(CHLOROMETHYL)PHENYLTRICHLOROSILANE |
| Silane, trichloro(4-(chloromethyl)phenyl)- |
| p-(Chloromethyl)phenyltrichlorosilane |
| Silane, trichloro(α-chloro-p-tolyl)- |
| Trichloro[4-(chloromethyl)phenyl]silane |