fumonisin B4 structure
|
Common Name | fumonisin B4 | ||
|---|---|---|---|---|
| CAS Number | 136379-60-7 | Molecular Weight | 689.83100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H59NO13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of fumonisin B4Fumonisin B4 is a derivative of fumonisin. Fumonisin B4 has low albumin binding capacity[1]. |
| Name | fumonisin B4 |
|---|
| Description | Fumonisin B4 is a derivative of fumonisin. Fumonisin B4 has low albumin binding capacity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C34H59NO13 |
|---|---|
| Molecular Weight | 689.83100 |
| Exact Mass | 689.39900 |
| PSA | 248.05000 |
| LogP | 5.32290 |
| InChIKey | WYYKRDVIBOEORL-JLCKPESSSA-N |
| SMILES | CCCCC(C)C(OC(=O)CC(CC(=O)O)C(=O)O)C(CC(C)CCCCCCCCC(O)C(C)N)OC(=O)CC(CC(=O)O)C(=O)O |