5-ethyl-1-(2-methylpropyl)-6-phenylsulfanyl-2-sulfanylidenepyrimidin-4-one structure
|
Common Name | 5-ethyl-1-(2-methylpropyl)-6-phenylsulfanyl-2-sulfanylidenepyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 136160-39-9 | Molecular Weight | 320.47300 | |
| Density | 1.23g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H20N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-1-(2-methylpropyl)-6-phenylsulfanyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.47300 |
| Exact Mass | 320.10200 |
| PSA | 95.44000 |
| LogP | 4.68780 |
| Index of Refraction | 1.638 |
| InChIKey | PANPMNUDCYWCPD-UHFFFAOYSA-N |
| SMILES | CCc1c(Sc2ccccc2)n(CC(C)C)c(=S)[nH]c1=O |
|
~%
5-ethyl-1-(2-me... CAS#:136160-39-9 |
| Literature: Tanaka, Hiromichi; Takashima, Hideaki; Ubasawa, Masaru; Sekiya, Kouichi; Nitta, Issei; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 25 p. 4713 - 4719 |
|
~%
5-ethyl-1-(2-me... CAS#:136160-39-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 35, # 25 p. 4713 - 4719 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-i-Bu-6PhS-5Et2thio U |
| 5-Ethyl-1-isobutyl-6-(phenylthio)-2-thiouracil |