changnanic acid
Modify Date: 2025-08-26 17:23:05
changnanic acid structure
|
Common Name | changnanic acid | ||
|---|---|---|---|---|
| CAS Number | 136040-44-3 | Molecular Weight | 468.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of changnanic acidChangnanic acid (schisandrin) is a triterpene compound with potential anti-tumor effects. Changnanic acid exhibits moderate cytotoxic activity against human tumor cell lines Bel-7402, MCF-7 and HL-60, with IC50s of 100 μM, 100 μM and 50.51 μM respectively[1]. |
| Name | changnanic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Changnanic acid (schisandrin) is a triterpene compound with potential anti-tumor effects. Changnanic acid exhibits moderate cytotoxic activity against human tumor cell lines Bel-7402, MCF-7 and HL-60, with IC50s of 100 μM, 100 μM and 50.51 μM respectively[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H44O4 |
|---|---|
| Molecular Weight | 468.66800 |
| Exact Mass | 468.32400 |
| PSA | 74.60000 |
| LogP | 7.26960 |
| InChIKey | DNVUNGJWEAUTQS-AXSJCNBFSA-N |
| SMILES | C=C(C)C1C=CC2(C)CCC34C(C(C)CCC=C(C)C(=O)O)C3(C)CCCC4C12CCC(=O)O |
| (Z)-(R)-6-[(3S,3aR,4aS,6aR,7R,9aS,9bS)-3a-(2-Carboxy-ethyl)-3-isopropenyl-6a,9a-dimethyl-3a,4,5,6,6a,7,8,9,9a,9b-decahydro-3H-cyclopenta[a]cyclopropa[e]naphthalen-7-yl]-2-methyl-hept-2-enoic acid |