4(3H)-Pyrimidinone,6-hydroxy-2-phenyl- structure
|
Common Name | 4(3H)-Pyrimidinone,6-hydroxy-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13566-71-7 | Molecular Weight | 188.18300 | |
| Density | 1.33g/cm3 | Boiling Point | 292.6ºC at 760mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8ºC | |
| Name | 4-hydroxy-2-phenyl-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 292.6ºC at 760mmHg |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 130.8ºC |
| Exact Mass | 188.05900 |
| PSA | 66.24000 |
| LogP | 1.55480 |
| Vapour Pressure | 0.00104mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | WTDXDRUHQKVYKO-UHFFFAOYSA-N |
| SMILES | O=c1cc(O)nc(-c2ccccc2)[nH]1 |
| HS Code | 2933599090 |
|---|
|
~79%
4(3H)-Pyrimidin... CAS#:13566-71-7 |
| Literature: JANUS BIOTHERAPEUTICS, INC.; LIPFORD, Grayson, B.; ZEPP, Charles, M. Patent: WO2012/167053 A1, 2012 ; Location in patent: Page/Page column 92 ; |
|
~73%
4(3H)-Pyrimidin... CAS#:13566-71-7 |
| Literature: Biagi; Giorgi; Livi; Scartoni; Lucacchini Farmaco, 1997 , vol. 52, # 1 p. 61 - 65 |
|
~%
4(3H)-Pyrimidin... CAS#:13566-71-7 |
| Literature: US5216159 A1, ; US 5216159 A |
|
~%
4(3H)-Pyrimidin... CAS#:13566-71-7 |
| Literature: US5597920 A1, ; US 5597920 A |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Phenyl-4,6-dihydroxy-pyrimidine |
| 2-phenyl-1H-pyrimidine-4,6-dione |
| 2-phenyl-pyrimidine-4,6-diol |
| phenylpyrimidinediol |
| 4,6-Dihydroxy-2-phenylpyrimidine |