2-Naphthanilide
Modify Date: 2025-09-02 14:07:40
2-Naphthanilide structure
|
Common Name | 2-Naphthanilide | ||
|---|---|---|---|---|
| CAS Number | 135-65-9 | Molecular Weight | 308.28800 | |
| Density | 1.449g/cm3 | Boiling Point | 448ºC at 760mmHg | |
| Molecular Formula | C17H12N2O4 | Melting Point | 246-247°C | |
| MSDS | N/A | Flash Point | 224.7ºC | |
Use of 2-Naphthanilide3-Hydroxy-3'-nitro-2-naphthanilide is a bioactive chemical. |
| Name | 3-Hydroxy-3'-nitro-2-naphthanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.449g/cm3 |
|---|---|
| Boiling Point | 448ºC at 760mmHg |
| Melting Point | 246-247°C |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.28800 |
| Flash Point | 224.7ºC |
| Exact Mass | 308.08000 |
| PSA | 95.15000 |
| LogP | 4.30210 |
| Vapour Pressure | 1.21E-08mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | YZJSKRBKHCLMQC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)c1cc2ccccc2cc1O |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. |
| Safety Phrases | S23-S24 |
| RIDADR | 2810 |
| WGK Germany | 2 |
| RTECS | BX3500000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2924299090 |
|
~58%
2-Naphthanilide CAS#:135-65-9 |
| Literature: Kos, Jiri; Zadrazilova, Iveta; Pesko, Matus; Keltosova, Stanislava; Tengler, Jan; Gonec, Tomas; Bobal, Pavel; Kauerova, Tereza; Oravec, Michal; Kollar, Peter; Cizek, Alois; Kralova, Katarina; Jampilek, Josef Molecules, 2013 , vol. 18, # 7 p. 7977 - 7997 |
|
~%
2-Naphthanilide CAS#:135-65-9 |
| Literature: Textile Colorist, vol. 51, p. 511 Chem. Zentralbl., , vol. 100, # II p. 2886 |
CAS#:10019-03-1![3-hydroxy-4-[(4-methyl-2-nitrophenyl)azo]-N-(3-nitrophenyl)naphthalene-2-carboxamide structure](https://image.chemsrc.com/caspic/209/3564-22-5.png)
CAS#:3564-22-5
CAS#:4880-11-9| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00021637 |
| 3-Hydroxy-N-(3-nitrophenyl)-2-naphthamide |
| 3-Hydroxy-N-(3-nitrophenyl)-2-naphthalenecarboxamide |
| 3-HYDROXY-3'-NITRO-2-NAPHTHANILIDE |
| 3-hydroxy-N-(3-nitrophenyl)naphthalene-2-carboxamide |
| 2-Hydroxy-3-naphthoic Acid m-Nitroanilide |
| Azoic Coupling Component 17 |
| Naphthol AS-BS |
| EINECS 205-209-2 |