Bis(3-triethoxysilylpropyl)amine structure
|
Common Name | Bis(3-triethoxysilylpropyl)amine | ||
|---|---|---|---|---|
| CAS Number | 13497-18-2 | Molecular Weight | 425.708 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 408.0±30.0 °C at 760 mmHg | |
| Molecular Formula | C18H43NO6Si2 | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 200.6±24.6 °C | |
| Name | 3-triethoxysilyl-N-(3-triethoxysilylpropyl)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.0±30.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C18H43NO6Si2 |
| Molecular Weight | 425.708 |
| Flash Point | 200.6±24.6 °C |
| Exact Mass | 425.262878 |
| PSA | 67.41000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.440 |
| InChIKey | RWLDCNACDPTRMY-UHFFFAOYSA-N |
| SMILES | CCO[Si](CCCNCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| Hazard Codes | C:Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S28-S36/37/39-S45 |
| RIDADR | UN 3267 |
| HS Code | 2931900090 |
|
~%
Bis(3-triethoxy... CAS#:13497-18-2 |
| Literature: Mem.Fac.Eng.Osaka City Univ., , vol. 1, p. 1,6,11 US2832754 , ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| bis-(3-triethoxysilanyl-propyl)-amine |
| Bis(3-(triethoxysilyl)propyl)amine |
| Bis(3-triethoxysilylpropyl)amine |
| 1-Propanamine, 3-(triethoxysilyl)-N-(3-(triethoxysilyl)propyl)- |
| 3-(Triethoxysilyl)-N-[3-(triethoxysilyl)propyl]-1-propanamine |
| bis-(3-triethoxysilylpropyl)amine |
| Bis-(3-triaethoxysilyl-propyl)-amin |
| 3-(Triethoxysilyl)-N-[3-(triethoxysilyl)propyl]propan-1-amine |
| EINECS 236-818-1 |
| MFCD00053750 |
| bis[3-(trimethoxysilyl)propyl]amine |
| N,N-bis(3-triethoxysilylpropyl)amine |
| 1-Propanamine,3-(triethoxysilyl)-N-[3-(triethoxysilyl)propyl] |
| 1-Propanamine, 3-(triethoxysilyl)-N-[3-(triethoxysilyl)propyl]- |
| Bis(triethoxysilylpropyl)amine |