Scrambled TRAP Fragment
Modify Date: 2025-09-18 11:29:19
Scrambled TRAP Fragment structure
|
Common Name | Scrambled TRAP Fragment | ||
|---|---|---|---|---|
| CAS Number | 1348418-97-2 | Molecular Weight | 747.89 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H57N11O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Scrambled TRAP FragmentScrambled TRAP Fragment is a scrambled sequence of TRAP Fragment. Scrambled TRAP Fragment with a random sequence of the amino acids that are the same as the active fragment. Scrambled TRAP Fragment usually used as a negative control. |
| Name | Scrambled TRAP Fragment |
|---|
| Description | Scrambled TRAP Fragment is a scrambled sequence of TRAP Fragment. Scrambled TRAP Fragment with a random sequence of the amino acids that are the same as the active fragment. Scrambled TRAP Fragment usually used as a negative control. |
|---|---|
| Related Catalog |
| Molecular Formula | C34H57N11O8 |
|---|---|
| Molecular Weight | 747.89 |
| InChIKey | WEPBSJWHRWHFRN-FRSCJGFNSA-N |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)C(N)Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(N)=O |