acetic acid; 2-[(2-aminoacetyl)amino]-3-phenyl-propanamide structure
|
Common Name | acetic acid; 2-[(2-aminoacetyl)amino]-3-phenyl-propanamide | ||
|---|---|---|---|---|
| CAS Number | 13467-26-0 | Molecular Weight | 281.30800 | |
| Density | N/A | Boiling Point | 540.6ºC at 760 mmHg | |
| Molecular Formula | C13H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.7ºC | |
| Name | acetic acid,2-[(2-aminoacetyl)amino]-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 540.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.30800 |
| Flash Point | 280.7ºC |
| Exact Mass | 281.13800 |
| PSA | 135.51000 |
| LogP | 1.04030 |
| Vapour Pressure | 9.41E-12mmHg at 25°C |
| InChIKey | UFYWNVUEIJKEMY-UHFFFAOYSA-N |
| SMILES | CC(=O)O.NCC(=O)NC(Cc1ccccc1)C(N)=O |
| HS Code | 2924299090 |
|---|
|
~58%
acetic acid; 2-... CAS#:13467-26-0 |
| Literature: Horwell; Beeby; Clark; Hughes Journal of Medicinal Chemistry, 1987 , vol. 30, # 4 p. 729 - 732 |
|
~%
acetic acid; 2-... CAS#:13467-26-0 |
| Literature: Fruton; Bergmann Journal of Biological Chemistry, 1942 , vol. 145, p. 253,260 |
|
~%
acetic acid; 2-... CAS#:13467-26-0 |
| Literature: Fruton; Bergmann Journal of Biological Chemistry, 1942 , vol. 145, p. 253,260 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| glycyl-L-phenylalanine amide acetate |
| H-Gly-Phe-NH2*CH3COOH |
| N-glycyl-L-phenylalanine amide,acetate |
| N-Glycyl-L-phenylalanin-amid,Acetat |
| Gly-Phe amide acetate |