Miglitol-d4 hydrochloride structure
|
Common Name | Miglitol-d4 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1346597-27-0 | Molecular Weight | 247.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14D4ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Miglitol-d4 hydrochlorideMiglitol-d4 (BAY1099-d4) hydrochloride is the deuterium labeled Miglitol. Miglitol is an oral anti-diabetic drug that acts by inhibiting the ability of the patient to breakdown complex carbohydrates into glucose[1][2]. |
| Name | Miglitol-d4 hydrochloride |
|---|
| Description | Miglitol-d4 (BAY1099-d4) hydrochloride is the deuterium labeled Miglitol. Miglitol is an oral anti-diabetic drug that acts by inhibiting the ability of the patient to breakdown complex carbohydrates into glucose[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C8H14D4ClNO5 |
|---|---|
| Molecular Weight | 247.71 |
| InChIKey | QHWGCVIAMMMOPR-FINLWVDLSA-N |
| SMILES | Cl.OCCN1CC(O)C(O)C(O)C1CO |