3-[2-[4-(2,4-difluorophenyl)phenyl]-2-oxoethyl]quinazolin-4-one structure
|
Common Name | 3-[2-[4-(2,4-difluorophenyl)phenyl]-2-oxoethyl]quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 134563-09-0 | Molecular Weight | 376.35600 | |
| Density | 1.3g/cm3 | Boiling Point | 550.8ºC at 760 mmHg | |
| Molecular Formula | C22H14F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.9ºC | |
| Name | 3-[2-[4-(2,4-difluorophenyl)phenyl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 550.8ºC at 760 mmHg |
| Molecular Formula | C22H14F2N2O2 |
| Molecular Weight | 376.35600 |
| Flash Point | 286.9ºC |
| Exact Mass | 376.10200 |
| PSA | 51.96000 |
| LogP | 4.22460 |
| Vapour Pressure | 3.53E-12mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | COWPHIXKMDOINN-UHFFFAOYSA-N |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)c1ccc(-c2ccc(F)cc2F)cc1 |
|
~%
3-[2-[4-(2,4-di... CAS#:134563-09-0 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 56, # 11.1 p. 2373 - 2381 |
|
~%
3-[2-[4-(2,4-di... CAS#:134563-09-0 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 56, # 11.1 p. 2373 - 2381 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2-(2',4'-Difluoro(1,1'-biphenyl)-4-yl)-2-oxoethyl)-4(3H)-quinazolinone |
| 4(3H)-Quinazolinone,3-(2-(2',4'-difluoro(1,1'-biphenyl)-4-yl)-2-oxoethyl) |