2-diethylaminoethyl 4-nitrobenzoate structure
|
Common Name | 2-diethylaminoethyl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 13456-39-8 | Molecular Weight | 266.29300 | |
| Density | 1.163g/cm3 | Boiling Point | 385.1ºC at 760mmHg | |
| Molecular Formula | C13H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 2-(diethylamino)ethyl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 385.1ºC at 760mmHg |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.29300 |
| Flash Point | 186.7ºC |
| Exact Mass | 266.12700 |
| PSA | 75.36000 |
| LogP | 2.61660 |
| Vapour Pressure | 3.91E-06mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | FRESWUPYXIRXMN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922199090 |
|---|
|
~%
2-diethylaminoe... CAS#:13456-39-8 |
| Literature: Giunta, Daniela; Masia, Maria Paola; Marchetti, Mauro; Morrone, Raffaele; Solinas, Maurizio Tetrahedron Letters, 2013 , vol. 54, # 37 p. 5122 - 5125 |
|
~%
2-diethylaminoe... CAS#:13456-39-8 |
| Literature: Einhorn; Uhlfelder Justus Liebigs Annalen der Chemie, 1909 , vol. 371, p. 139 |
|
~%
2-diethylaminoe... CAS#:13456-39-8 |
| Literature: Hoechster Farbw. Patent: DE179627 ; |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Diethylaminoethyl 4-nitrobenzoate |
| 4-Nitro-benzoesaeure-<2-diaethylamino-aethylester> |
| 4-nitro-benzoic acid-(2-diethylamino-ethyl ester) |
| 2-Diethylaminoethyl p-nitrobenzoat |
| 2-Diethylaminoethyl p-nitrobenzoate |